C22H25N3O2 — CID 71063711
ethyl 3-[2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate (PubChem CID 71063711) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 3-[2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate.
| Compound Name | ethyl 3-[2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate |
|---|---|
| PubChem CID | 71063711 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | ethyl 3-[2-(pyridin-3-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]propanoate |
| SMILES | CCOC(=O)CCn1c2c(c3ccccc31)CN(Cc1cccnc1)CC2 |
| InChI | InChI=1S/C22H25N3O2/c1-2-27-22(26)10-13-25-20-8-4-3-7-18(20)19-16-24(12-9-21(19)25)15-17-6-5-11-23-14-17/h3-8,11,14H,2,9-10,12-13,15-16H2,1H3 |
| InChIKey | CGFUPLANLSZKBL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|