C28H29N3O2 — CID 70800165
4-[[2-[(3-methoxyphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-methylbenzamide (PubChem CID 70800165) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-[[2-[(3-methoxyphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-[[2-[(3-methoxyphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 70800165 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-[[2-[(3-methoxyphenyl)methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Cn2c3c(c4ccccc42)CN(Cc2cccc(OC)c2)CC3)cc1 |
| InChI | InChI=1S/C28H29N3O2/c1-29-28(32)22-12-10-20(11-13-22)18-31-26-9-4-3-8-24(26)25-19-30(15-14-27(25)31)17-21-6-5-7-23(16-21)33-2/h3-13,16H,14-15,17-19H2,1-2H3,(H,29,32) |
| InChIKey | QHESGSHIPODKBN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|