C23H28N4O3 — CID 164771737
4-[[2-[2-(2-aminoethoxy)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-hydroxybenzamide (PubChem CID 164771737) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[[2-[2-(2-aminoethoxy)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[2-[2-(2-aminoethoxy)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164771737 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[[2-[2-(2-aminoethoxy)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]methyl]-N-hydroxybenzamide |
| SMILES | NCCOCCN1CCc2c(c3ccccc3n2Cc2ccc(C(=O)NO)cc2)C1 |
| InChI | InChI=1S/C23H28N4O3/c24-10-13-30-14-12-26-11-9-22-20(16-26)19-3-1-2-4-21(19)27(22)15-17-5-7-18(8-6-17)23(28)25-29/h1-8,29H,9-16,24H2,(H,25,28) |
| InChIKey | SEPBXJIWASWOHQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|