C30H35N5O5 — CID 137397845
N-hydroxy-4-[[4-methyl-3,6-dioxo-15-(2-piperidin-1-ylethoxy)-4,7,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl]methyl]benzamide (PubChem CID 137397845) has the molecular formula C30H35N5O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-hydroxy-4-[[4-methyl-3,6-dioxo-15-(2-piperidin-1-ylethoxy)-4,7,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[4-methyl-3,6-dioxo-15-(2-piperidin-1-ylethoxy)-4,7,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl]methyl]benzamide |
|---|---|
| PubChem CID | 137397845 |
| Molecular Formula | C30H35N5O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | N-hydroxy-4-[[4-methyl-3,6-dioxo-15-(2-piperidin-1-ylethoxy)-4,7,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraen-11-yl]methyl]benzamide |
| SMILES | CN1CC(=O)N2CCc3c(c4cc(OCCN5CCCCC5)ccc4n3Cc3ccc(C(=O)NO)cc3)C2C1=O |
| InChI | InChI=1S/C30H35N5O5/c1-32-19-26(36)34-14-11-25-27(28(34)30(32)38)23-17-22(40-16-15-33-12-3-2-4-13-33)9-10-24(23)35(25)18-20-5-7-21(8-6-20)29(37)31-39/h5-10,17,28,39H,2-4,11-16,18-19H2,1H3,(H,31,37) |
| InChIKey | ROFSEICNTHSBME-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|