C33H40N4O5 — CID 155619113
tert-butyl 4-[[4-methyl-14-(3-morpholin-4-ylpropyl)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate (PubChem CID 155619113) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is tert-butyl 4-[[4-methyl-14-(3-morpholin-4-ylpropyl)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[4-methyl-14-(3-morpholin-4-ylpropyl)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate |
|---|---|
| PubChem CID | 155619113 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | tert-butyl 4-[[4-methyl-14-(3-morpholin-4-ylpropyl)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate |
| SMILES | CN1C(=O)C2c3c(n(Cc4ccc(C(=O)OC(C)(C)C)cc4)c4ccc(CCCN5CCOCC5)cc34)CCN2C1=O |
| InChI | InChI=1S/C33H40N4O5/c1-33(2,3)42-31(39)24-10-7-23(8-11-24)21-37-26-12-9-22(6-5-14-35-16-18-41-19-17-35)20-25(26)28-27(37)13-15-36-29(28)30(38)34(4)32(36)40/h7-12,20,29H,5-6,13-19,21H2,1-4H3 |
| InChIKey | MCRDFLKUQSEKJN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|