C24H24N4O4 — CID 130264306
4-[(5-ethoxy-14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide (PubChem CID 130264306) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[(5-ethoxy-14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide.
| Compound Name | 4-[(5-ethoxy-14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 130264306 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[(5-ethoxy-14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzamide |
| SMILES | CCOc1ccc2c(c1)c1c(n2Cc2ccc(C(N)=O)cc2)CN2CC1C(=O)N(C)C2=O |
| InChI | InChI=1S/C24H24N4O4/c1-3-32-16-8-9-19-17(10-16)21-18-12-27(24(31)26(2)23(18)30)13-20(21)28(19)11-14-4-6-15(7-5-14)22(25)29/h4-10,18H,3,11-13H2,1-2H3,(H2,25,29) |
| InChIKey | PMYQSDPSMPMCDT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|