C24H23N3O4 — CID 130265469
3-[4-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)methyl]phenyl]propanoic acid (PubChem CID 130265469) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[4-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 130265469 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-[4-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)methyl]phenyl]propanoic acid |
| SMILES | CN1C(=O)C2CN(Cc3c2c2ccccc2n3Cc2ccc(CCC(=O)O)cc2)C1=O |
| InChI | InChI=1S/C24H23N3O4/c1-25-23(30)18-13-26(24(25)31)14-20-22(18)17-4-2-3-5-19(17)27(20)12-16-8-6-15(7-9-16)10-11-21(28)29/h2-9,18H,10-14H2,1H3,(H,28,29) |
| InChIKey | WAFKOTKMVSDZMX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|