C30H32N4O5 — CID 130264150
(E)-3-[3-[2-(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)ethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 130264150) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is (E)-3-[3-[2-(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)ethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[3-[2-(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)ethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 130264150 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (E)-3-[3-[2-(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-9-yl)ethyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | CN1C(=O)C2CN(Cc3c2c2ccccc2n3CCc2cccc(/C=C/C(=O)NOC3CCCCO3)c2)C1=O |
| InChI | InChI=1S/C30H32N4O5/c1-32-29(36)23-18-33(30(32)37)19-25-28(23)22-9-2-3-10-24(22)34(25)15-14-21-8-6-7-20(17-21)12-13-26(35)31-39-27-11-4-5-16-38-27/h2-3,6-10,12-13,17,23,27H,4-5,11,14-16,18-19H2,1H3,(H,31,35)/b13-12+ |
| InChIKey | XHXJDBCVKMLTSE-OUKQBFOZSA-N |
| XLogP | 3.96 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|