C25H31FN4O3 — CID 87636745
(E)-3-[5-fluoro-6-[[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87636745) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is (E)-3-[5-fluoro-6-[[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-fluoro-6-[[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87636745 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (E)-3-[5-fluoro-6-[[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(N[C@@H]2CCN(CCc3ccccc3)C2)c(F)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C25H31FN4O3/c26-22-16-20(9-10-23(31)29-33-24-8-4-5-15-32-24)17-27-25(22)28-21-12-14-30(18-21)13-11-19-6-2-1-3-7-19/h1-3,6-7,9-10,16-17,21,24H,4-5,8,11-15,18H2,(H,27,28)(H,29,31)/b10-9+/t21-,24?/m1/s1 |
| InChIKey | QKHWCKNAHHVBDF-PVCNZBHCSA-N |
| XLogP | 3.54 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|