C25H29FN4O5 — CID 173125053
[(3R)-1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid (PubChem CID 173125053) has the molecular formula C25H29FN4O5 and a molecular weight of 484.53 g/mol. Its IUPAC name is [(3R)-1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid.
| Compound Name | [(3R)-1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 173125053 |
| Molecular Formula | C25H29FN4O5 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [(3R)-1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-[5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]carbamic acid |
| SMILES | O=C(C=Cc1ccc(N(C(=O)O)[C@@H]2CCN(Cc3ccccc3F)C2)nc1)NOC1CCCCO1 |
| InChI | InChI=1S/C25H29FN4O5/c26-21-6-2-1-5-19(21)16-29-13-12-20(17-29)30(25(32)33)22-10-8-18(15-27-22)9-11-23(31)28-35-24-7-3-4-14-34-24/h1-2,5-6,8-11,15,20,24H,3-4,7,12-14,16-17H2,(H,28,31)(H,32,33)/t20-,24?/m1/s1 |
| InChIKey | KCQNYAUWRTWGJP-CGHJUBPDSA-N |
| XLogP | 3.57 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|