C31H42N4O5 — CID 87635911
tert-butyl N-[(3R)-1-[(3,4-dimethylphenyl)methyl]pyrrolidin-3-yl]-N-[6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]carbamate (PubChem CID 87635911) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(3,4-dimethylphenyl)methyl]pyrrolidin-3-yl]-N-[6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(3,4-dimethylphenyl)methyl]pyrrolidin-3-yl]-N-[6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 87635911 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(3,4-dimethylphenyl)methyl]pyrrolidin-3-yl]-N-[6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]carbamate |
| SMILES | Cc1ccc(CN2CC[C@@H](N(C(=O)OC(C)(C)C)c3ccc(/C=C/C(=O)NOC4CCCCO4)nc3)C2)cc1C |
| InChI | InChI=1S/C31H42N4O5/c1-22-9-10-24(18-23(22)2)20-34-16-15-27(21-34)35(30(37)39-31(3,4)5)26-13-11-25(32-19-26)12-14-28(36)33-40-29-8-6-7-17-38-29/h9-14,18-19,27,29H,6-8,15-17,20-21H2,1-5H3,(H,33,36)/b14-12+/t27-,29?/m1/s1 |
| InChIKey | MSNOMRWUTJILFK-ILTMJQMGSA-N |
| XLogP | 5.30 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|