C24H30FN5O4 — CID 91317550
3-[5-[[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 91317550) has the molecular formula C24H30FN5O4 and a molecular weight of 471.53 g/mol. Its IUPAC name is 3-[5-[[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | 3-[5-[[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 91317550 |
| Molecular Formula | C24H30FN5O4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 3-[5-[[(3R)-1-[(5-fluoro-2-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | COc1ccc(F)cc1CN1CC[C@@H](Nc2cnc(C=CC(=O)NOC3CCCCO3)cn2)C1 |
| InChI | InChI=1S/C24H30FN5O4/c1-32-21-7-5-18(25)12-17(21)15-30-10-9-20(16-30)28-22-14-26-19(13-27-22)6-8-23(31)29-34-24-4-2-3-11-33-24/h5-8,12-14,20,24H,2-4,9-11,15-16H2,1H3,(H,27,28)(H,29,31)/t20-,24?/m1/s1 |
| InChIKey | YKRZAPJTFOAERK-CGHJUBPDSA-N |
| XLogP | 2.90 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|