C25H39N5O3 — CID 87280616
(E)-3-[5-[[(3R)-1-(2-cyclohexylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87280616) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-(2-cyclohexylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-[[(3R)-1-(2-cyclohexylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87280616 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-(2-cyclohexylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(N[C@@H]2CCCN(CCC3CCCCC3)C2)cn1)NOC1CCCCO1 |
| InChI | InChI=1S/C25H39N5O3/c31-24(29-33-25-10-4-5-16-32-25)12-11-21-17-27-23(18-26-21)28-22-9-6-14-30(19-22)15-13-20-7-2-1-3-8-20/h11-12,17-18,20,22,25H,1-10,13-16,19H2,(H,27,28)(H,29,31)/b12-11+/t22-,25?/m1/s1 |
| InChIKey | XALMIDKZXJVZDJ-XKSZBCQHSA-N |
| XLogP | 3.91 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|