C31H42N6O5 — CID 59242347
(2R)-N'-benzyl-N-(cyclohexylmethyl)-N'-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]butanediamide (PubChem CID 59242347) has the molecular formula C31H42N6O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is (2R)-N'-benzyl-N-(cyclohexylmethyl)-N'-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]butanediamide.
| Compound Name | (2R)-N'-benzyl-N-(cyclohexylmethyl)-N'-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]butanediamide |
|---|---|
| PubChem CID | 59242347 |
| Molecular Formula | C31H42N6O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | (2R)-N'-benzyl-N-(cyclohexylmethyl)-N'-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]butanediamide |
| SMILES | CN(Cc1ccccc1)C(=O)C[C@@H](Nc1cnc(/C=C/C(=O)NOC2CCCCO2)cn1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C31H42N6O5/c1-37(22-24-12-6-3-7-13-24)29(39)18-26(31(40)34-19-23-10-4-2-5-11-23)35-27-21-32-25(20-33-27)15-16-28(38)36-42-30-14-8-9-17-41-30/h3,6-7,12-13,15-16,20-21,23,26,30H,2,4-5,8-11,14,17-19,22H2,1H3,(H,33,35)(H,34,40)(H,36,38)/b16-15+/t26-,30?/m1/s1 |
| InChIKey | OKFQGAIJCSKHBP-FPJZYKPWSA-N |
| XLogP | 3.59 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|