C25H33N5O4 — CID 59242341
(2R)-3-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]-N-[(1S)-1-phenylethyl]butanamide (PubChem CID 59242341) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]-N-[(1S)-1-phenylethyl]butanamide.
| Compound Name | (2R)-3-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]-N-[(1S)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 59242341 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (2R)-3-methyl-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]-N-[(1S)-1-phenylethyl]butanamide |
| SMILES | CC(C)[C@@H](Nc1cnc(/C=C/C(=O)NOC2CCCCO2)cn1)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H33N5O4/c1-17(2)24(25(32)28-18(3)19-9-5-4-6-10-19)29-21-16-26-20(15-27-21)12-13-22(31)30-34-23-11-7-8-14-33-23/h4-6,9-10,12-13,15-18,23-24H,7-8,11,14H2,1-3H3,(H,27,29)(H,28,32)(H,30,31)/b13-12+/t18-,23?,24+/m0/s1 |
| InChIKey | GPCCPGHSGFPYRJ-GSKXOJFZSA-N |
| XLogP | 3.38 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|