C23H28ClN5O3 — CID 87637718
(E)-3-[5-[[(3R)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87637718) has the molecular formula C23H28ClN5O3 and a molecular weight of 457.96 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-[[(3R)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87637718 |
| Molecular Formula | C23H28ClN5O3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(N[C@@H]2CCN(Cc3cccc(Cl)c3)C2)cn1)NOC1CCCCO1 |
| InChI | InChI=1S/C23H28ClN5O3/c24-18-5-3-4-17(12-18)15-29-10-9-20(16-29)27-21-14-25-19(13-26-21)7-8-22(30)28-32-23-6-1-2-11-31-23/h3-5,7-8,12-14,20,23H,1-2,6,9-11,15-16H2,(H,26,27)(H,28,30)/b8-7+/t20-,23?/m1/s1 |
| InChIKey | WPRYOLHYXCOAOO-LYJVLZRRSA-N |
| XLogP | 3.40 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|