C19H22N4O2 — CID 68964812
(E)-3-[5-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid (PubChem CID 68964812) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68964812 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-[(4-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
| SMILES | Cc1ccc(CN2CC[C@@H](Nc3cnc(/C=C/C(=O)O)cn3)C2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-2-4-15(5-3-14)12-23-9-8-17(13-23)22-18-11-20-16(10-21-18)6-7-19(24)25/h2-7,10-11,17H,8-9,12-13H2,1H3,(H,21,22)(H,24,25)/b7-6+/t17-/m1/s1 |
| InChIKey | SVCLQOPRKKYVDR-DKRLNXSXSA-N |
| XLogP | 2.57 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|