C20H25N5O2 — CID 91122127
ethyl 3-[5-[[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 91122127) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 3-[5-[[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[5-[[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91122127 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | ethyl 3-[5-[[(3R)-1-(pyridin-4-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cnc(N[C@@H]2CCCN(Cc3ccncc3)C2)cn1 |
| InChI | InChI=1S/C20H25N5O2/c1-2-27-20(26)6-5-17-12-23-19(13-22-17)24-18-4-3-11-25(15-18)14-16-7-9-21-10-8-16/h5-10,12-13,18H,2-4,11,14-15H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | ZFSHAYVVCKEADF-GOSISDBHSA-N |
| XLogP | 2.52 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|