C21H26N4O2 — CID 140500508
ethyl (E)-3-[5-[[(3R)-1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 140500508) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is ethyl (E)-3-[5-[[(3R)-1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-[[(3R)-1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 140500508 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | ethyl (E)-3-[5-[[(3R)-1-[(2-methylphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(N[C@@H]2CCN(Cc3ccccc3C)C2)cn1 |
| InChI | InChI=1S/C21H26N4O2/c1-3-27-21(26)9-8-18-12-23-20(13-22-18)24-19-10-11-25(15-19)14-17-7-5-4-6-16(17)2/h4-9,12-13,19H,3,10-11,14-15H2,1-2H3,(H,23,24)/b9-8+/t19-/m1/s1 |
| InChIKey | LLIYZIQFOPKIFY-CSHXORCISA-N |
| XLogP | 3.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|