C19H24N4O2S — CID 140500534
ethyl (E)-3-[5-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 140500534) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is ethyl (E)-3-[5-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 140500534 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | ethyl (E)-3-[5-[[(3R)-1-(thiophen-3-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(N[C@@H]2CCCN(Cc3ccsc3)C2)cn1 |
| InChI | InChI=1S/C19H24N4O2S/c1-2-25-19(24)6-5-16-10-21-18(11-20-16)22-17-4-3-8-23(13-17)12-15-7-9-26-14-15/h5-7,9-11,14,17H,2-4,8,12-13H2,1H3,(H,21,22)/b6-5+/t17-/m1/s1 |
| InChIKey | WLPLFQNRGCLFQT-FUTAKVPZSA-N |
| XLogP | 3.19 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|