C17H20N4O2S — CID 69340376
(E)-3-[5-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid (PubChem CID 69340376) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (E)-3-[5-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69340376 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (E)-3-[5-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NC2CCCN(Cc3cccs3)C2)cn1 |
| InChI | InChI=1S/C17H20N4O2S/c22-17(23)6-5-13-9-19-16(10-18-13)20-14-3-1-7-21(11-14)12-15-4-2-8-24-15/h2,4-6,8-10,14H,1,3,7,11-12H2,(H,19,20)(H,22,23)/b6-5+ |
| InChIKey | LKQFNIVTQRISOC-AATRIKPKSA-N |
| XLogP | 2.71 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|