C20H23N5O3 — CID 87636471
[[(E)-3-[5-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoyl]amino] acetate (PubChem CID 87636471) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is [[(E)-3-[5-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoyl]amino] acetate.
| Compound Name | [[(E)-3-[5-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoyl]amino] acetate |
|---|---|
| PubChem CID | 87636471 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [[(E)-3-[5-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)/C=C/c1cnc(N[C@@H]2CCN(Cc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C20H23N5O3/c1-15(26)28-24-20(27)8-7-17-11-22-19(12-21-17)23-18-9-10-25(14-18)13-16-5-3-2-4-6-16/h2-8,11-12,18H,9-10,13-14H2,1H3,(H,22,23)(H,24,27)/b8-7+/t18-/m1/s1 |
| InChIKey | HWYQFHPMQZBFEX-LKGOPFMKSA-N |
| XLogP | 1.77 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|