C23H28N4O3 — CID 87636200
[[(E)-3-[6-[[(3R)-1-[(2,3-dimethylphenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate (PubChem CID 87636200) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is [[(E)-3-[6-[[(3R)-1-[(2,3-dimethylphenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate.
| Compound Name | [[(E)-3-[6-[[(3R)-1-[(2,3-dimethylphenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate |
|---|---|
| PubChem CID | 87636200 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [[(E)-3-[6-[[(3R)-1-[(2,3-dimethylphenyl)methyl]pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)/C=C/c1ccc(N[C@@H]2CCN(Cc3cccc(C)c3C)C2)nc1 |
| InChI | InChI=1S/C23H28N4O3/c1-16-5-4-6-20(17(16)2)14-27-12-11-21(15-27)25-22-9-7-19(13-24-22)8-10-23(29)26-30-18(3)28/h4-10,13,21H,11-12,14-15H2,1-3H3,(H,24,25)(H,26,29)/b10-8+/t21-/m1/s1 |
| InChIKey | YDIWKDYZOXJCLE-ZQAUEJBPSA-N |
| XLogP | 2.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|