C23H24N4O4 — CID 87636640
[[(E)-3-[6-[[(3R)-1-(1-benzofuran-2-ylmethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate (PubChem CID 87636640) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is [[(E)-3-[6-[[(3R)-1-(1-benzofuran-2-ylmethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate.
| Compound Name | [[(E)-3-[6-[[(3R)-1-(1-benzofuran-2-ylmethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate |
|---|---|
| PubChem CID | 87636640 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [[(E)-3-[6-[[(3R)-1-(1-benzofuran-2-ylmethyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)/C=C/c1ccc(N[C@@H]2CCN(Cc3cc4ccccc4o3)C2)nc1 |
| InChI | InChI=1S/C23H24N4O4/c1-16(28)31-26-23(29)9-7-17-6-8-22(24-13-17)25-19-10-11-27(14-19)15-20-12-18-4-2-3-5-21(18)30-20/h2-9,12-13,19H,10-11,14-15H2,1H3,(H,24,25)(H,26,29)/b9-7+/t19-/m1/s1 |
| InChIKey | YYDFCGGTPQONJC-QRBZPYHOSA-N |
| XLogP | 3.12 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|