C22H28N4O2 — CID 67129348
methyl 3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 67129348) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl 3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67129348 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl 3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(N[C@@H]2CCCN(CCCc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C22H28N4O2/c1-28-22(27)12-11-19-15-24-21(16-23-19)25-20-10-6-14-26(17-20)13-5-9-18-7-3-2-4-8-18/h2-4,7-8,11-12,15-16,20H,5-6,9-10,13-14,17H2,1H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | LYQCGRCXNIBJEY-HXUWFJFHSA-N |
| XLogP | 3.17 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|