C20H25N5O3 — CID 136501071
N-hydroxy-3-[5-[[(3R)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide (PubChem CID 136501071) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-hydroxy-3-[5-[[(3R)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[5-[[(3R)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 136501071 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-hydroxy-3-[5-[[(3R)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide |
| SMILES | COc1ccc(CCN2CC[C@@H](Nc3cnc(C=CC(=O)NO)cn3)C2)cc1 |
| InChI | InChI=1S/C20H25N5O3/c1-28-18-5-2-15(3-6-18)8-10-25-11-9-17(14-25)23-19-13-21-16(12-22-19)4-7-20(26)24-27/h2-7,12-13,17,27H,8-11,14H2,1H3,(H,22,23)(H,24,26)/t17-/m1/s1 |
| InChIKey | XPMYVIVLEIAARV-QGZVFWFLSA-N |
| XLogP | 1.73 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|