C19H21F2N5O2 — CID 135900404
(E)-3-[5-[[(3R)-1-[2-(2,6-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide (PubChem CID 135900404) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-[2-(2,6-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[5-[[(3R)-1-[2-(2,6-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 135900404 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-[2-(2,6-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(N[C@@H]2CCN(CCc3c(F)cccc3F)C2)cn1)NO |
| InChI | InChI=1S/C19H21F2N5O2/c20-16-2-1-3-17(21)15(16)7-9-26-8-6-14(12-26)24-18-11-22-13(10-23-18)4-5-19(27)25-28/h1-5,10-11,14,28H,6-9,12H2,(H,23,24)(H,25,27)/b5-4+/t14-/m1/s1 |
| InChIKey | LTKMRDYATQIKBY-ISZGNANSSA-N |
| XLogP | 2.00 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|