C21H29Cl2N5O2 — CID 135900425
(E)-N-hydroxy-3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide;dihydrochloride (PubChem CID 135900425) has the molecular formula C21H29Cl2N5O2 and a molecular weight of 454.40 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide;dihydrochloride.
| Compound Name | (E)-N-hydroxy-3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 135900425 |
| Molecular Formula | C21H29Cl2N5O2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (E)-N-hydroxy-3-[5-[[(3R)-1-(3-phenylpropyl)piperidin-3-yl]amino]pyrazin-2-yl]prop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(/C=C/c1cnc(N[C@@H]2CCCN(CCCc3ccccc3)C2)cn1)NO |
| InChI | InChI=1S/C21H27N5O2.2ClH/c27-21(25-28)11-10-18-14-23-20(15-22-18)24-19-9-5-13-26(16-19)12-4-8-17-6-2-1-3-7-17;;/h1-3,6-7,10-11,14-15,19,28H,4-5,8-9,12-13,16H2,(H,23,24)(H,25,27);2*1H/b11-10+;;/t19-;;/m1../s1 |
| InChIKey | FSGWNINTEGFTLJ-VLHGWARXSA-N |
| XLogP | 3.35 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|