C19H24Cl2FN5O2 — CID 135900392
(E)-3-[5-[[(3R)-1-[2-(3-fluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride (PubChem CID 135900392) has the molecular formula C19H24Cl2FN5O2 and a molecular weight of 444.34 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-[2-(3-fluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride.
| Compound Name | (E)-3-[5-[[(3R)-1-[2-(3-fluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 135900392 |
| Molecular Formula | C19H24Cl2FN5O2 |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-[2-(3-fluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(/C=C/c1cnc(N[C@@H]2CCN(CCc3cccc(F)c3)C2)cn1)NO |
| InChI | InChI=1S/C19H22FN5O2.2ClH/c20-15-3-1-2-14(10-15)6-8-25-9-7-17(13-25)23-18-12-21-16(11-22-18)4-5-19(26)24-27;;/h1-5,10-12,17,27H,6-9,13H2,(H,22,23)(H,24,26);2*1H/b5-4+;;/t17-;;/m1../s1 |
| InChIKey | DKTDWWIRAWIRSW-RJOVDZFVSA-N |
| XLogP | 2.71 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|