C20H25Cl2F2N5O2 — CID 173048741
3-[5-[[(3R)-1-[2-(2,4-difluorophenyl)ethyl]piperidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride (PubChem CID 173048741) has the molecular formula C20H25Cl2F2N5O2 and a molecular weight of 476.36 g/mol. Its IUPAC name is 3-[5-[[(3R)-1-[2-(2,4-difluorophenyl)ethyl]piperidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride.
| Compound Name | 3-[5-[[(3R)-1-[2-(2,4-difluorophenyl)ethyl]piperidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 173048741 |
| Molecular Formula | C20H25Cl2F2N5O2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-[5-[[(3R)-1-[2-(2,4-difluorophenyl)ethyl]piperidin-3-yl]amino]pyrazin-2-yl]-N-hydroxyprop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(C=Cc1cnc(N[C@@H]2CCCN(CCc3ccc(F)cc3F)C2)cn1)NO |
| InChI | InChI=1S/C20H23F2N5O2.2ClH/c21-15-4-3-14(18(22)10-15)7-9-27-8-1-2-17(13-27)25-19-12-23-16(11-24-19)5-6-20(28)26-29;;/h3-6,10-12,17,29H,1-2,7-9,13H2,(H,24,25)(H,26,28);2*1H/t17-;;/m1../s1 |
| InChIKey | MSHZEMSFHKAPEB-ZEECNFPPSA-N |
| XLogP | 3.24 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|