C20H22F2N4O2 — CID 90741378
methyl 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 90741378) has the molecular formula C20H22F2N4O2 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90741378 |
| Molecular Formula | C20H22F2N4O2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(N[C@@H]2CCN(CCc3ccc(F)c(F)c3)C2)cn1 |
| InChI | InChI=1S/C20H22F2N4O2/c1-28-20(27)5-3-15-11-24-19(12-23-15)25-16-7-9-26(13-16)8-6-14-2-4-17(21)18(22)10-14/h2-5,10-12,16H,6-9,13H2,1H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | ZSFOMVWZLFQPMW-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|