C20H21F2IN4O2 — CID 69154476
3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]-2-iodopiperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid (PubChem CID 69154476) has the molecular formula C20H21F2IN4O2 and a molecular weight of 514.31 g/mol. Its IUPAC name is 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]-2-iodopiperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]-2-iodopiperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69154476 |
| Molecular Formula | C20H21F2IN4O2 |
| Molecular Weight | 514.31 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]-2-iodopiperidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc(N[C@@H]2CCCN(CCc3ccc(F)c(F)c3)C2I)cn1 |
| InChI | InChI=1S/C20H21F2IN4O2/c21-15-5-3-13(10-16(15)22)7-9-27-8-1-2-17(20(27)23)26-18-12-24-14(11-25-18)4-6-19(28)29/h3-6,10-12,17,20H,1-2,7-9H2,(H,25,26)(H,28,29)/t17-,20?/m1/s1 |
| InChIKey | DCPHVUKVRZWUGN-DIAVIDTQSA-N |
| XLogP | 3.73 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|