C19H21IN4O3 — CID 69338656
3-[5-[[(3R)-2-iodo-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid (PubChem CID 69338656) has the molecular formula C19H21IN4O3 and a molecular weight of 480.31 g/mol. Its IUPAC name is 3-[5-[[(3R)-2-iodo-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[(3R)-2-iodo-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69338656 |
| Molecular Formula | C19H21IN4O3 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-[5-[[(3R)-2-iodo-1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
| SMILES | COc1cccc(CN2CC[C@@H](Nc3cnc(C=CC(=O)O)cn3)C2I)c1 |
| InChI | InChI=1S/C19H21IN4O3/c1-27-15-4-2-3-13(9-15)12-24-8-7-16(19(24)20)23-17-11-21-14(10-22-17)5-6-18(25)26/h2-6,9-11,16,19H,7-8,12H2,1H3,(H,22,23)(H,25,26)/t16-,19?/m1/s1 |
| InChIKey | AKAWQKZAUCUSBI-VTBWFHPJSA-N |
| XLogP | 3.03 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|