C20H22F2N4O2 — CID 67128835
(E)-3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid (PubChem CID 67128835) has the molecular formula C20H22F2N4O2 and a molecular weight of 388.42 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67128835 |
| Molecular Formula | C20H22F2N4O2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-[2-(3,4-difluorophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1cnc(N[C@@H]2CCN(CCc3ccc(F)c(F)c3)C2)cn1)C(=O)O |
| InChI | InChI=1S/C20H22F2N4O2/c1-13(20(27)28)8-16-10-24-19(11-23-16)25-15-5-7-26(12-15)6-4-14-2-3-17(21)18(22)9-14/h2-3,8-11,15H,4-7,12H2,1H3,(H,24,25)(H,27,28)/b13-8+/t15-/m1/s1 |
| InChIKey | UKQZHSKFBDNZQH-XETPBLJFSA-N |
| XLogP | 2.97 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|