C20H23BrN4O2 — CID 67128918
3-[5-[[(3R)-1-[2-(4-bromophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid (PubChem CID 67128918) has the molecular formula C20H23BrN4O2 and a molecular weight of 431.33 g/mol. Its IUPAC name is 3-[5-[[(3R)-1-[2-(4-bromophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[5-[[(3R)-1-[2-(4-bromophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67128918 |
| Molecular Formula | C20H23BrN4O2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-[5-[[(3R)-1-[2-(4-bromophenyl)ethyl]pyrrolidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1cnc(N[C@@H]2CCN(CCc3ccc(Br)cc3)C2)cn1)C(=O)O |
| InChI | InChI=1S/C20H23BrN4O2/c1-14(20(26)27)10-18-11-23-19(12-22-18)24-17-7-9-25(13-17)8-6-15-2-4-16(21)5-3-15/h2-5,10-12,17H,6-9,13H2,1H3,(H,23,24)(H,26,27)/t17-/m1/s1 |
| InChIKey | VTRQIDAVEIQFFH-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|