C20H30N4O2 — CID 67128791
(E)-3-[5-[[(3R)-1-(2-cyclopentylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid (PubChem CID 67128791) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (E)-3-[5-[[(3R)-1-(2-cyclopentylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[5-[[(3R)-1-(2-cyclopentylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67128791 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (E)-3-[5-[[(3R)-1-(2-cyclopentylethyl)piperidin-3-yl]amino]pyrazin-2-yl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1cnc(N[C@@H]2CCCN(CCC3CCCC3)C2)cn1)C(=O)O |
| InChI | InChI=1S/C20H30N4O2/c1-15(20(25)26)11-18-12-22-19(13-21-18)23-17-7-4-9-24(14-17)10-8-16-5-2-3-6-16/h11-13,16-17H,2-10,14H2,1H3,(H,22,23)(H,25,26)/b15-11+/t17-/m1/s1 |
| InChIKey | MGJPILKGBUGWOT-GSPCDJLXSA-N |
| XLogP | 3.42 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|