C24H26N4O2 — CID 67128896
2-methyl-3-[5-[[(3R)-1-(2-naphthalen-1-ylethyl)pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid (PubChem CID 67128896) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-methyl-3-[5-[[(3R)-1-(2-naphthalen-1-ylethyl)pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid.
| Compound Name | 2-methyl-3-[5-[[(3R)-1-(2-naphthalen-1-ylethyl)pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67128896 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-methyl-3-[5-[[(3R)-1-(2-naphthalen-1-ylethyl)pyrrolidin-3-yl]amino]pyrazin-2-yl]prop-2-enoic acid |
| SMILES | CC(=Cc1cnc(N[C@@H]2CCN(CCc3cccc4ccccc34)C2)cn1)C(=O)O |
| InChI | InChI=1S/C24H26N4O2/c1-17(24(29)30)13-21-14-26-23(15-25-21)27-20-10-12-28(16-20)11-9-19-7-4-6-18-5-2-3-8-22(18)19/h2-8,13-15,20H,9-12,16H2,1H3,(H,26,27)(H,29,30)/t20-/m1/s1 |
| InChIKey | WUMLGZZUWGUAEF-HXUWFJFHSA-N |
| XLogP | 3.85 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|