C20H24N4O2 — CID 86603679
ethyl (E)-3-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enoate (PubChem CID 86603679) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86603679 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethyl (E)-3-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]pyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(N[C@@H]2CCN(Cc3ccccc3)C2)nc1 |
| InChI | InChI=1S/C20H24N4O2/c1-2-26-19(25)9-8-17-12-21-20(22-13-17)23-18-10-11-24(15-18)14-16-6-4-3-5-7-16/h3-9,12-13,18H,2,10-11,14-15H2,1H3,(H,21,22,23)/b9-8+/t18-/m1/s1 |
| InChIKey | AJNBDSDESGGXFA-GFOMBABLSA-N |
| XLogP | 2.74 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|