C19H22FN3O2 — CID 68963376
ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-5-fluoropyridine-3-carboxylate (PubChem CID 68963376) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-5-fluoropyridine-3-carboxylate.
| Compound Name | ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-5-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 68963376 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-5-fluoropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N[C@@H]2CCN(Cc3ccccc3)C2)c(F)c1 |
| InChI | InChI=1S/C19H22FN3O2/c1-2-25-19(24)15-10-17(20)18(21-11-15)22-16-8-9-23(13-16)12-14-6-4-3-5-7-14/h3-7,10-11,16H,2,8-9,12-13H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | MTAJSLUCIKGUJY-MRXNPFEDSA-N |
| XLogP | 3.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |