C19H21ClFN3O2 — CID 86603759
ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-chloro-5-fluoropyridine-3-carboxylate (PubChem CID 86603759) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-chloro-5-fluoropyridine-3-carboxylate.
| Compound Name | ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-chloro-5-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 86603759 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | ethyl 6-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-chloro-5-fluoropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(F)c(N[C@@H]2CCN(Cc3ccccc3)C2)nc1Cl |
| InChI | InChI=1S/C19H21ClFN3O2/c1-2-26-19(25)15-10-16(21)18(23-17(15)20)22-14-8-9-24(12-14)11-13-6-4-3-5-7-13/h3-7,10,14H,2,8-9,11-12H2,1H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | FLBNXSANCBMWAJ-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|