C24H23Cl2FN4O — CID 71495154
2-[(1-benzylpiperidin-4-yl)amino]-6-chloro-N-(3-chlorophenyl)-5-fluoropyridine-3-carboxamide (PubChem CID 71495154) has the molecular formula C24H23Cl2FN4O and a molecular weight of 473.38 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]-6-chloro-N-(3-chlorophenyl)-5-fluoropyridine-3-carboxamide.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]-6-chloro-N-(3-chlorophenyl)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 71495154 |
| Molecular Formula | C24H23Cl2FN4O |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]-6-chloro-N-(3-chlorophenyl)-5-fluoropyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc(F)c(Cl)nc1NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H23Cl2FN4O/c25-17-7-4-8-19(13-17)29-24(32)20-14-21(27)22(26)30-23(20)28-18-9-11-31(12-10-18)15-16-5-2-1-3-6-16/h1-8,13-14,18H,9-12,15H2,(H,28,30)(H,29,32) |
| InChIKey | CZSMPCXEGMYJBZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|