C26H28Cl2N4O2 — CID 90386351
6-chloro-N-(3-chlorophenyl)-2-[[1-(3-hydroxy-1-phenylpropyl)piperidin-4-yl]amino]pyridine-3-carboxamide (PubChem CID 90386351) has the molecular formula C26H28Cl2N4O2 and a molecular weight of 499.44 g/mol. Its IUPAC name is 6-chloro-N-(3-chlorophenyl)-2-[[1-(3-hydroxy-1-phenylpropyl)piperidin-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(3-chlorophenyl)-2-[[1-(3-hydroxy-1-phenylpropyl)piperidin-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90386351 |
| Molecular Formula | C26H28Cl2N4O2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 6-chloro-N-(3-chlorophenyl)-2-[[1-(3-hydroxy-1-phenylpropyl)piperidin-4-yl]amino]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(Cl)nc1NC1CCN(C(CCO)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28Cl2N4O2/c27-19-7-4-8-21(17-19)30-26(34)22-9-10-24(28)31-25(22)29-20-11-14-32(15-12-20)23(13-16-33)18-5-2-1-3-6-18/h1-10,17,20,23,33H,11-16H2,(H,29,31)(H,30,34) |
| InChIKey | MQHLVDJPSBPBAH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|