C25H28N4O — CID 90394099
2-[(1-benzylpiperidin-4-yl)amino]-N-(3-methylphenyl)pyridine-3-carboxamide (PubChem CID 90394099) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]-N-(3-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-(3-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90394099 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-(3-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccnc2NC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H28N4O/c1-19-7-5-10-22(17-19)28-25(30)23-11-6-14-26-24(23)27-21-12-15-29(16-13-21)18-20-8-3-2-4-9-20/h2-11,14,17,21H,12-13,15-16,18H2,1H3,(H,26,27)(H,28,30) |
| InChIKey | SDJDKKXJJLQZDA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |