C20H23BrN4O — CID 133320105
N-(4-bromophenyl)-2-[(1-prop-2-enylpiperidin-4-yl)amino]pyridine-3-carboxamide (PubChem CID 133320105) has the molecular formula C20H23BrN4O and a molecular weight of 415.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(1-prop-2-enylpiperidin-4-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-2-[(1-prop-2-enylpiperidin-4-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133320105 |
| Molecular Formula | C20H23BrN4O |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(4-bromophenyl)-2-[(1-prop-2-enylpiperidin-4-yl)amino]pyridine-3-carboxamide |
| SMILES | C=CCN1CCC(Nc2ncccc2C(=O)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H23BrN4O/c1-2-12-25-13-9-17(10-14-25)23-19-18(4-3-11-22-19)20(26)24-16-7-5-15(21)6-8-16/h2-8,11,17H,1,9-10,12-14H2,(H,22,23)(H,24,26) |
| InChIKey | NXOZRSKNQSCOJJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|