C17H19N3O3 — CID 84574680
2-(cyclopropylamino)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 84574680) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(cyclopropylamino)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84574680 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(cyclopropylamino)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccnc2NC2CC2)cc1OC |
| InChI | InChI=1S/C17H19N3O3/c1-22-14-8-7-12(10-15(14)23-2)20-17(21)13-4-3-9-18-16(13)19-11-5-6-11/h3-4,7-11H,5-6H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | HWOLHZWFFGPSPH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |