C28H26Cl2N4O6 — CID 87509097
2-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide;6-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 87509097) has the molecular formula C28H26Cl2N4O6 and a molecular weight of 585.44 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide;6-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide;6-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87509097 |
| Molecular Formula | C28H26Cl2N4O6 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 2-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide;6-chloro-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)nc2)cc1OC.COc1ccc(NC(=O)c2cccnc2Cl)cc1OC |
| InChI | InChI=1S/2C14H13ClN2O3/c1-19-11-5-4-10(7-12(11)20-2)17-14(18)9-3-6-13(15)16-8-9;1-19-11-6-5-9(8-12(11)20-2)17-14(18)10-4-3-7-16-13(10)15/h2*3-8H,1-2H3,(H,17,18) |
| InChIKey | DMDCCCOASGOVFW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|