C16H24N4O3 — CID 133352925
propan-2-yl 4-[[3-(methylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 133352925) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is propan-2-yl 4-[[3-(methylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[3-(methylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133352925 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | propan-2-yl 4-[[3-(methylcarbamoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CNC(=O)c1cccnc1NC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C16H24N4O3/c1-11(2)23-16(22)20-9-6-12(7-10-20)19-14-13(15(21)17-3)5-4-8-18-14/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H,17,21)(H,18,19) |
| InChIKey | HJLQALYKQMOQMY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |