C14H18N4O2 — CID 24710040
ethyl 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 24710040) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24710040 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | ethyl 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ncccc2C#N)CC1 |
| InChI | InChI=1S/C14H18N4O2/c1-2-20-14(19)18-8-5-12(6-9-18)17-13-11(10-15)4-3-7-16-13/h3-4,7,12H,2,5-6,8-9H2,1H3,(H,16,17) |
| InChIKey | IQBSTWYYRWLJSH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |