C22H29N6O3- — CID 163737924
[5-[amino(oxido)amino]-2-adamantyl] 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 163737924) has the molecular formula C22H29N6O3- and a molecular weight of 425.51 g/mol. Its IUPAC name is [5-[amino(oxido)amino]-2-adamantyl] 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | [5-[amino(oxido)amino]-2-adamantyl] 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163737924 |
| Molecular Formula | C22H29N6O3- |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [5-[amino(oxido)amino]-2-adamantyl] 4-[(3-cyano-2-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | N#Cc1cccnc1NC1CCN(C(=O)OC2C3CC4CC2CC(N(N)[O-])(C4)C3)CC1 |
| InChI | InChI=1S/C22H29N6O3/c23-13-15-2-1-5-25-20(15)26-18-3-6-27(7-4-18)21(29)31-19-16-8-14-9-17(19)12-22(10-14,11-16)28(24)30/h1-2,5,14,16-19H,3-4,6-12,24H2,(H,25,26)/q-1 |
| InChIKey | ZCVIIJJFJPJAMY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|