C15H22BrN3O2 — CID 133360474
propan-2-yl 4-[(5-bromo-3-methyl-2-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 133360474) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is propan-2-yl 4-[(5-bromo-3-methyl-2-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[(5-bromo-3-methyl-2-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 133360474 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | propan-2-yl 4-[(5-bromo-3-methyl-2-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | Cc1cc(Br)cnc1NC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-10(2)21-15(20)19-6-4-13(5-7-19)18-14-11(3)8-12(16)9-17-14/h8-10,13H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | FMSLVIMQOHWJGN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |